Zu "1150701-66-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK1940029
Artikelnummer: TGM-T5427-100mg
Description: GSK1940029 (SCD inhibitor 1) is an inhibitor of stearoyl-CoA desaturase (SCD). Target: Dehydrogenase, Stearoyl-CoA Desaturase (SCD). Smiles: Cc1c(nnn1Cc1ccc(Cl)c(Cl)c1)C(=O)Nc1ccc(CO)cc1. References: Anne Marie Jeanne Bouillot, et al. 1, 2, 3-triazole derivatives for use as stearoyl-coa desaturase...
| Schlagworte: | SCD inhibitor 1 |
| Anwendung: | Stearoyl-CoA desaturase inhibitor |
| CAS | 1150701-66-8 |
| MW: | 391.25 D |
ab 31,00 €
GSK1940029
Artikelnummer: Cay36704-1
GSK1940029 is a stearoyl-CoA desaturase (SCD) inhibitor. It increases palmitate-induced phosphorylation of p70 ribosomal S6 kinase 1 (p70S6K1) and lactate dehydrogenase (LDH) release from AML12 hepatocytes when used at a concentration of 20 µM. GSK1940029 (10 µM) also increases palmitate-induced increases in...
| Schlagworte: | 1-[(3,4-dichlorophenyl)methyl]-N-[4-(hydroxymethyl)phenyl]-5-methyl-1H-1,2,3-triazole-4-carboxamide |
| Anwendung: | Stearoyl-CoA desaturase inhibitor |
| CAS | 1150701-66-8 |
| MW: | 391.3 D |
ab 35,00 €
