Zu "114727-43-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SU5201
Artikelnummer: TGM-T3571-10mg
Description: NSC 247030 inhibits interleukin 2 (IL-2) production. Target: Others, Interleukin. Smiles: Clc1ccc(\C=C2/C(=O)Nc3ccccc23)cc1Cl
| Schlagworte: | NSC 247030 |
| Anwendung: | IL-2 production inhibitor |
| CAS | 114727-43-4 |
| MW: | 290.14 D |
ab 47,00 €
SU 5201
Artikelnummer: Cay34333-1
SU 5201 is an inhibitor of IL-2 production. It inhibits IL-2 production in peripheral blood mononuclear cells (PBMCs) with an IC50 value of 1 nM. SU 5201 also inhibits VEGF- or acidic FGF-induced proliferation of human umbilical vein endothelial cells (HUVECs) when used at concentrations of 2.5 and 2.3 µM,...
| Schlagworte: | NSC 247030, 3-[(3,4-dichlorophenyl)methylene]-1,3-dihydro-2H-indol-2-one |
| Anwendung: | IL-2 production inhibitor |
| CAS | 114727-43-4 |
| MW: | 290.1 D |
ab 166,00 €
