Zu "1143-70-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Urolithin A
Artikelnummer: LKT-U698574.100
Urolithins are microflora metabolites of dietary ellagic acid derivatives, such as ellagitannins. SMILES: C1=CC2=C(C=C1O)C(=O)OC3=C2C=CC(=C3)O
| Schlagworte: | 3,8-dihydroxy-6H-benzo[c]chromen-6-one, 3,8-Dihydroxyurolithin, 3,8-dihydroxybenzo[c]chromen-6-one,... |
| Anwendung: | Ellagic acid derivative produced by gut microflora |
| CAS | 1143-70-0 |
| MW: | 228.2 D |
ab 95,00 €
Urolithin A
Artikelnummer: TGM-T7174-5mg
Description: Urolithin A is a natural product, a metabolite of ellagic acid, which inhibits DNA synthesis and induces apoptosis and autophagy. Urolithin A exhibits antioxidant, anti-inflammatory and antitumor activities. Target: Drug Metabolite, Apoptosis, Autophagy, DNA/RNA Synthesis, Endogenous Metabolite,...
| CAS | 1143-70-0 |
| MW: | 228.2 D |
ab 42,00 €
Urolithin A
Artikelnummer: Cay22607-5
Urolithin A is a secondary metabolite of ellagic acid (Cay-10569), a polyphenolic antioxidant, that has antiproliferative, anti-inflammatory, and anti-oxidant properties. It decreases proliferation in ECC-1, Ishikawa, and HEC-1A human endometrial cancer cell lines at a concentration of 1 µM, arrests the cell cycle...
| Schlagworte: | 2',7-Dihydroxy-3,4-benzocoumarin, 3,8-Dihydroxy Urolithin, 3,8-dihydroxy-6H-dibenzo[b,d]pyran-6-one |
| Anwendung: | Antiproliferative, antiinflammatory antioxidant |
| CAS | 1143-70-0 |
| MW: | 228.2 D |
ab 47,00 €
