Zu "114014-15-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Z-Phe-Tyr(tBu)-diazomethylketone
Artikelnummer: TGM-T35753-1mg
Description: Irreversible cathepsin L inhibitor which is ca 10'000 times more effective in inactivating cathepsin L than cathepsin S. Target: Others. Smiles: CC(C)(C)Oc1ccc(C[C@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)C(=O)C=[N+]=[N-])cc1
| Anwendung: | Cathepsin L inhibitor |
| CAS | 114014-15-2 |
| MW: | 542.636 D |
ab 93,00 €
Z-Phe-Tyr(tBu)-diazomethylketone
Artikelnummer: Cay27877-1
Z-Phe-Tyr(tBu)-diazomethylketone is an inhibitor of cathepsin L (Kinact = 200,000 M-1s-1). It is selective for cathepsin L over cathepsin S and cathepsin B (Kinacts = 30 and 10.3 M-1s-1, respectively). Z-Phe-Tyr(tBu)-diazomethylketone is active against bloodstream forms of T. brucei brucei clone 427-221a in vitro...
| Schlagworte: | Cbz-Phe-Tyr(O-t-Bu)-CHN2, Z-Phe-Tyr(tBu)-CHN2,... |
| Anwendung: | Cathepsin L inhibitor |
| CAS | 114014-15-2 |
| MW: | 542.6 D |
ab 52,00 €
