Zu "1139-83-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Urolithin B
Artikelnummer: LKT-U698576.10
Urolithins are microflora metabolites of dietary ellagic acid derivatives, such as ellagitannins. SMILES: C1=CC=C2C(=C1)C3=C(C=C(C=C3)O)OC2=O
| Schlagworte: | 3-hydroxybenzo[c]chromen-6-one |
| Anwendung: | Ellagic acid derivative produced by gut microflora |
| CAS | 1139-83-9 |
| MW: | 212.2 D |
ab 109,00 €
Urolithin B
Artikelnummer: TGM-T13265-100mg
Description: Urolithin B is one of the gut microbial metabolites of ellagitannins and is found in diverse plant foods, including pomegranates, berries, walnuts, tropical fruits, and medicinal herbs. Urolithin B inhibits NF-kappaB activity by reducing the phosphorylation and degradation of IkappaBalpha, and...
| CAS | 1139-83-9 |
| MW: | 212.2 D |
ab 40,00 €
Urolithin B
Artikelnummer: Cay33757-1
Urolithin B is a metabolite of the polyphenolic antioxidant ellagic acid (Cay-10569) that has diverse biological activities. It is formed from ellagic acid via several intermediates by gut microbiota. Urolithin B reduces the levels of advanced glycation end products (AGEs) in a cell-free assay in a...
| Schlagworte: | 3-hydroxy Urolithin, NSC 94726, 3-hydroxy-6H-dibenzo[b,d]pyran-6-one |
| Anwendung: | Ellagic acid metabolite |
| CAS | 1139-83-9 |
| MW: | 212.2 D |
ab 128,00 €
