Zu "1135695-98-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Q-VD-OPH
Artikelnummer: TGM-T0282-100mg
Description: Q-VD-OPH (Quinoline-Val-Asp-Difluorophenoxymethylketone) is a pan-caspase inhibitor with potent antiapoptotic properties. Target: Caspase, HIV Protease. Smiles: CC(C)[C@H](NC(=O)c1ccc2ccccc2n1)C(=O)N[C@@H](CC(O)=O)C(=O)COc1c(F)cccc1F. References: Mischak R. ICN Bioconcepts. 2002, 8, 1-5.
| Schlagworte: | Quinoline-Val-Asp-Difluorophenoxymethylketone |
| CAS | 1135695-98-5 |
| MW: | 513.5 D |
ab 47,00 €
Q-VD-OPH
Artikelnummer: Cay15260-1
Q-VD-OPH is a broad-spectrum caspase inhibitor, blocking caspases-3, -7, -8, -9, -10, and -12 and inhibiting apoptosis when used at 10 µM. It more effectively inhibits apoptosis and is much less cytotoxic than Z-VAD-FMK (Cay-14463) and Boc-D-FMK (Cay-16118). Q-VD-OPH can be used in vivo, where it has been shown to...
| Schlagworte: | Quinoline-Val-Asp-Difluorophenoxymethyl Ketone,... |
| Anwendung: | Caspase inhibitor, apoptosis inhibitor |
| CAS | 1135695-98-5 |
| MW: | 513.5 D |
ab 163,00 €
