Zu "1132654-54-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
lurasidone-d8
Artikelnummer: TGM-TMIH-0313-10mg
Description: lurasidone-d8 is a deuterated compound of lurasidone. Smiles: [2H]C1([2H])N(C[C@@H]2CCCC[C@H]2CN2C(=O)[C@H]3[C@@H]4CC[C@@H](C4)[C@H]3C2=O)C([2H])([2H])C([2H])([2H])N(C2=NSC3=CC=CC=C23)C1([2H])[2H]
| Anwendung: | GC-MS, LC-MS, internal standard |
| CAS | 1132654-54-6 |
| MW: | 500.73 D |
ab 887,00 €
Lurasidone-d8
Artikelnummer: Cay25222-1
Lurasidone-d8 is intended for use as an internal standard for the quantification of lurasidone (Cay-9000570) by GC- or LC-MS. Lurasidone is an atypical antipsychotic that binds to dopamine D2, serotonin (5-HT) receptor subtypes 5-HT2A, 5-HT1A, and 5-HT7, and alpha2C-adrenergic receptors (Kis = 1.68, 2.03, 6.75,...
| Schlagworte: | (3aR,4S,7R,7aS)-2-[[(1R,2R)-2-[[4-(1,2-benzisothiazol-3-yl)-1-piperazinyl-2,2,3,3,5,5,6,6-d8]methyl]cyclohexyl]methyl]hexa... |
| Anwendung: | GC-MS, LC-MS, internal standard |
| CAS | 1132654-54-6 |
| MW: | 500.7 D |
624,00 €
