Zu "112-80-1" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Oleic Acid
Artikelnummer: Cay90260-500
Oleic acid is a monounsaturated fatty acid and a major component of membrane phospholipids that has been found in human plasma, cell membranes, and adipose tissue. It contributes approximately 17% of the total fatty acids esterified to phosphatidylcholine, the major phospholipid class in porcine platelets. Oleic...
| Schlagworte: | cis-9-Octadecenoic acid, 9Z-octadecenoic acid |
| Anwendung: | Bioactive lipid assays |
| CAS | 112-80-1 |
| MW: | 282.5 D |
ab 29,00 €
Oleic acid
Artikelnummer: TGM-T2O2668-1mL
Description: Oleic acid (Glycon Wo) is a natural product, a common monounsaturated fatty acid found in a variety of animal and vegetable fats and oils. Palmitic acid is a Na+/K+ ATPase activator. Target: ATPase, Apoptosis, Others, Endogenous Metabolite. Smiles: C(C/C=C\CCCCCCCC)CCCCCC(O)=O. References: Li S, et...
| Schlagworte: | Elaidoic acid, 9Z-Octadecenoic acid, Oleate, Glycon Wo, 9-cis-Octadecenoic acid, 9-Octadecenoic Acid |
| CAS | 112-80-1 |
| MW: | 282.46 D |
ab 31,00 €
![Oleic Acid-[13C5]](/custom/plugins/NetiThemeBiomol/Resources/Themes/Frontend/Biomol/frontend/_public/src/img/no-picture.jpg "Oleic Acid-[13C5]")
Oleic Acid-[13C5]
Artikelnummer: ISO-S14375-1.0
Isotope Incorporation: >99%
| Schlagworte: | Carbon-13-labelled, CAS of labelled compound: 1255644-48-4 |
| Anwendung: | LC/MS internal standard |
| CAS | 112-80-1 |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Oleic Acid
Artikelnummer: ISO-S14375UNL-1.0
| Schlagworte: | unlabelled |
| CAS | 112-80-1 |
| MW: | 282 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
