Zu "110871-86-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Sparfloxacin
Artikelnummer: TGM-T1095-100mg
Description: Sparfloxacin (CI-978) is a fluoroquinolone antibiotic that inhibits bacterial DNA gyrase, thus preventing DNA replication and transcription. Target: DNA gyrase, Antibacterial, Topoisomerase, Antibiotic. Smiles: FC1=C2C(C(=O)C(C(O)=O)=CN2C3CC3)=C(N)C(F)=C1N4C[C@H](C)N[C@H](C)C4. References: Nakamura...
| Schlagworte: | Zagam, CI-978, AT-4140, PD 131501 |
| CAS | 110871-86-8 |
| MW: | 392.4 D |
ab 42,00 €
Sparfloxacin
Artikelnummer: Cay20379-1
Sparfloxacin is a fluoroquinolone antibiotic that inhibits bacterial DNA gyrase, thereby inhibiting DNA replication and transcription. It is active against S. aureus with an MIC value of 0.031 µg/ml.Formal Name:...
| Schlagworte: | AT-4140, CI-978, CP 103,826, PD 131501, PD 1315-1,... |
| Anwendung: | Antibacterial, Topoisomerase / gyrase inhibitor |
| CAS | 110871-86-8 |
| MW: | 392.4 D |
ab 43,00 €
Sparfloxacin
Artikelnummer: LKT-S6000.1
A fluoroquniolone antibacterial, acts on DNA gyrase.
| Schlagworte: | SPFX |
| Anwendung: | Antibacterial agent, Topoisomerase IV inhibitor |
| CAS | 110871-86-8 |
| MW: | 392,4 D |
ab 67,00 €
