Zu "110703-94-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Zopolrestat
Artikelnummer: TGM-T35317-10mg
Description: Zopolrestat (CP 73850) is a potent inhibitor of aldose reductase (IC50 = 3.1 nM). Target: Reductase. Smiles: OC(=O)Cc1nn(Cc2nc3cc(ccc3s2)C(F)(F)F)c(=O)c2ccccc12. References: Mylari BL, et al. Novel, potent aldose reductase inhibitors: 3,4-dihydro-4-oxo-3-[[5-(trifluoromethyl)-2-benzothiazolyl]...
| Schlagworte: | Zopolrestatum, CP 73850, CP73850, CP-73850 |
| Anwendung: | Targets aldehyde reductase [EC:1.1.1.21] (AKR1B) |
| CAS | 110703-94-1 |
| MW: | 419.38 D |
ab 31,00 €
Zopolrestat
Artikelnummer: Cay29185-1
Zopolrestat is a potent inhibitor of aldose reductase (IC50s = 1.9 and 41 nM for the human placenta and rat lens enzymes, respectively). It inhibits sorbitol accumulation in human and rat erythrocytes (IC50s = 370 and 220 nM, respectively). Zopolrestat (50 µM) inhibits ethanol-induced aldose reductase activity and...
| Schlagworte: | 3,4-dihydro-4-oxo-3-[[5-(trifluoromethyl)-2-benzothiazolyl]methyl]-1-phthalazineacetic acid |
| Anwendung: | Aldose reductase inhibitor |
| CAS | 110703-94-1 |
| MW: | 419.4 D |
ab 44,00 €
