Zu "1105698-15-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Salermide
Artikelnummer: TGM-T3953-100mg
Description: Salermide, an inhibitor of Sirt1 and Sirt2, induces cancer-specific apoptotic cell death. Target: Sirtuin, Apoptosis. Smiles: CC(C(=O)Nc1cccc(c1)\N=C\c1c(O)ccc2ccccc12)c1ccccc1. References: Lara E, et al. Oncogene. 2009, 28(6):781-91.
| Anwendung: | SIRT inhibitor |
| CAS | 1105698-15-4 |
| MW: | 394.47 D |
ab 42,00 €
Salermide
Artikelnummer: Cay13178-10
The sirtuins (SIRTs) are a family of NAD+-dependent histone deacetylases involved in gene regulation that is relevant to, e.g., longevity, cancer, gene regulation, energy homeostasis, and apoptosis. Salermide is an inhibitor of SIRT1 and SIRT2, causing tumor-specific apoptotic cell death. In MOLT4 leukemia cells,...
| Schlagworte: | N-[3-[[(2-hydroxy-1-naphthalenyl)methylene]amino]phenyl]-a-methyl-benzeneacetamide |
| Anwendung: | SIRT inhibitor |
| CAS | 1105698-15-4 |
| MW: | 394.5 D |
ab 69,00 €
Salermide
Artikelnummer: LKT-S0344.10
Salermide is an inhibitor of sirtuins that exhibits anti-parasitic and anticancer chemotherapeutic activities. In Schistosoma mansoni, salermide decreases egg-laying activity, disrupts morphology of reproductive organs, and induces apoptosis and cell death. In breast cancer cells, salermide downregulates expression...
| Anwendung: | SIRT inhibitor |
| CAS | 1105698-15-4 |
| MW: | 394.47 D |
ab 177,00 €
