Zu "1103500-20-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LY2562175
Artikelnummer: TGM-T15806-100mg
Description: LY2562175 is an effective and selective FXR agonist (EC50: 193 nM). Target: FXR, Autophagy. Smiles: Cn1cc(C(O)=O)c2ccc(cc12)N1CCC(CC1)OCc1c(onc1-c1c(Cl)cccc1Cl)C1CC1. References: Genin MJ, et al. Discovery of...
| Anwendung: | Bile acid receptor (FXR) agonist |
| CAS | 1103500-20-4 |
| MW: | 540.44 D |
ab 159,00 €
LY2562175
Artikelnummer: Cay28912-1
LY2562175 is a farnesoid X receptor (FXR) agonist (EC50 = 193 nM in a reporter assay). It is selective for FXR over the glucocorticoid, androgen, mineralocorticoid, and progesterone receptors in HEK293 cells overexpressing the human receptors (EC50s = >10 µM for all in a radioligand binding assay). LY2562175...
| Schlagworte: | 6-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4-isoxazolyl]methoxy]-1-piperidinyl]-1-methyl-1H-indole-3-carboxylic acid |
| Anwendung: | Bile acid receptor (FXR) agonist |
| CAS | 1103500-20-4 |
| MW: | 540.4 D |
ab 141,00 €
