Zu "1088965-37-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK-923295
Artikelnummer: TGM-T2039-100mg
Description: GSK923295 is a selective allosteric inhibitor of CENP-E kinesin motor ATPase(Ki=3.2 nM). Target: Kinesin, Apoptosis. Smiles: CC(C)Oc1ccc(cc1Cl)C(=O)N[C@H](CNC(=O)CN(C)C)Cc1ccc(cc1)-c1cn2cccc([C@H](C)O)c2n1. References: Wood KW, et al. Proc Natl Acad Sci U S A, 2010, 107(13), 5839-5844.
| Anwendung: | CENP-E inhibitor |
| CAS | 1088965-37-0 |
| MW: | 592.13 D |
ab 45,00 €
GSK923295
Artikelnummer: Cay18389-1
GSK923295 is a potent inhibitor of centromere-associated protein E (CENP-E, Ki = 3.2 nM), a kinesin motor protein involved in mitotic checkpoint signaling. GSK923295 causes mitotic cell cycle delay, leading to apoptosis in various cancer cell lines. It induces apoptosis in cancer cells in mice bearing xenografts of...
| Schlagworte: | GSK923295A,... |
| Anwendung: | CENP-E inhibitor |
| CAS | 1088965-37-0 |
| MW: | 592.1 D |
ab 45,00 €
