Zu "108319-06-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Temafloxacin
Artikelnummer: TGM-T19794-10mg
Description: Temafloxacin (Omniflox) is an antibiotic and antimycobacterial agent. It used to treat lower respiratory tract infections, genital and urinary infections like prostatitis, and skin infections. Target: Antibiotic. Smiles: CC1CN(CCN1)c1cc2n(cc(C(O)=O)c(=O)c2cc1F)-c1ccc(F)cc1F. References: G A Pankey....
| Schlagworte: | Omniflox |
| Anwendung: | Antibiotic, DNA topoisomerase inhibitor |
| CAS | 108319-06-8 |
| MW: | 417.38 D |
ab 34,00 €
Temafloxacin
Artikelnummer: Cay17352-1
Temafloxacin is a fluoroquinolone antibiotic that acts as a DNA topoisomerase inhibitor. It has broad antimicrobial activity against gram-positive and gram-negative bacteria, such as S. pneumoniae, M. hominis, and anaerobic bacteria, including B. fragilis.Formal Name:...
| Schlagworte: | A-62254, 1-(2,4-difluorophenyl)-6-fluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid |
| Anwendung: | Antibiotic, DNA topoisomerase inhibitor |
| CAS | 108319-06-8 |
| MW: | 417.4 D |
ab 60,00 €
