Zu "107220-28-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cevimeline hydrochloride
Artikelnummer: TGM-T20131-2mg
Description: Cevimeline HCl is an agonist of cholinergic that binds to muscarinic receptors. Muscarinic agonists in sufficient dosage can enhance the secretion of exocrine glands, such as salivary and sweat glands. Target: Others. Smiles: Cl.C[C@@H]1O[C@@]2(CS1)CN1CCC2CC1. References: Malallah OS, Garcia CMA,...
| Schlagworte: | Evoxac, Cevimeline HCl |
| Anwendung: | Muscarinic receptor agonist |
| CAS | 107220-28-0 |
| MW: | 235.77 D |
58,00 €
Cevimeline (hydrochloride)
Artikelnummer: Cay17802-1
Cevimeline is a muscarinic receptor agonist (EC50s = 23, 48, and 63 nM for M1, M3, and M5, respectively, and >1 µM for M2 and M4). It stimulates secretion by salivary glands and is useful in ameliorating xerostomia (dry mouth).Formal Name:...
| Schlagworte: | AF 102B, SNI 2011, SNK 508, (2'R,3R)-rel-2'-methyl-spiro[1-azabicyclo[2.2.2]octane-3,5'-[1,3]oxathiolane], monohydrochloride |
| Anwendung: | Muscarinic receptor agonist |
| CAS | 107220-28-0 |
| MW: | 235.8 D |
ab 50,00 €
