Zu "1062444-54-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1V209
Artikelnummer: TGM-T8316-100mg
Description: 1V209 (TLR7 agonist T7) is a Toll-like receptor 7 (TLR7) agonist known for its anti-tumor properties. Target: TLR. Smiles: COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(cc3)C(O)=O)c2n1. References: Gold Nanoparticles Coimmobilized with Small Molecule Toll-Like Receptor 7 Ligand and alpha-Mannose as Adjuvants[J]....
| Schlagworte: | TLR7 agonist T7 |
| Anwendung: | Benzoic-acid modified purine, TLR7 agonist precursor |
| CAS | 1062444-54-5 |
| MW: | 359.34 D |
ab 33,00 €
1V209
Artikelnummer: Cay38318-10
1V209 is a benzoic acid-modified purine that, when conjugated to polysaccharides or sterols, acts as a toll-like receptor 7 (TLR7) agonist. A variety of 1V209-polysaccharide conjugates, but not 1V209 alone, increase TNF-alpha secretion from RAW 264.7 macrophages and IL-6 secretion from bone marrow-derived dendritic...
| Schlagworte: | TLR7 Agonist T7, Toll-Like Receptor 7 Agonist T7,... |
| Anwendung: | Benzoic-acid modified purine, TLR7 agonist precursor |
| CAS | 1062444-54-5 |
| MW: | 359.3 D |
ab 135,00 €
