Zu "1061353-68-1" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PND-1186
Artikelnummer: TGM-T1950-100mg
Description: PND-1186 (VS-4718) is a specific and reversible FAK inhibitor with an IC50 of 1.5 nM. Target: Apoptosis, FAK. Smiles: CNC(=O)c1ccccc1Nc1cc(Nc2ccc(cc2OC)N2CCOCC2)ncc1C(F)(F)F. References: Tanjoni I, et al. Cancer Biol Ther. 2010, 9(10), 764-777.
| Schlagworte: | VS-4718, SR-2516, PND 1186, PND1186 |
| Anwendung: | FAK inhibitor |
| CAS | 1061353-68-1 |
| MW: | 501.5 D |
ab 48,00 €
PND1186
Artikelnummer: Cay17668-5
PND1186 is a potent reversible focal adhesion kinase (FAK) inhibitor with an IC50 value of 1.5 nM against the recombinant enzyme and 100 nM in breast carcinoma cells. It promotes 4T1 breast carcinoma and ID8 ovarian carcinoma cell apoptosis when grown in anchorage-independent 3D cultures but had limited efficacy in...
| Schlagworte: | SR 2516, VS-4718, 2-[[2-[[2-methoxy-4-(4-morpholinyl)phenyl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methyl-benzamide |
| Anwendung: | FAK inhibitor |
| CAS | 1061353-68-1 |
| MW: | 501.5 D |
ab 77,00 €
VS-4718
Artikelnummer: LKT-V720004.5
Focal adhesion kinase (FAK) inhibitor.
| Schlagworte: | VS-4718, VS 4718, VS4718, SR-2516, SR 2516, SR2516, PND-1186, PND 1186, PND1186 |
| Anwendung: | FAK inhibitor |
| CAS | 1061353-68-1 |
| MW: | 501.51 D |
ab 117,00 €
