Zu "1051375-16-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dolutegravir
Artikelnummer: TGM-T6198-100mg
Description: Dolutegravir (GSK1349572) (IC50=2.7 nM), a two-metal-binding HIV integrase inhibitor, exhibits medium activity against raltegravir-resistant signature mutants Y143R, Q148K, N155H, and G140S/Q148H. Target: HIV Protease. Smiles: C[C@@H]1CCO[C@H]2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N12. References:...
| Schlagworte: | S/GSK1349572, GSK1349572 |
| Anwendung: | Targets HIV-1 integrase (IN) |
| CAS | 1051375-16-6 |
| MW: | 419.38 D |
ab 31,00 €
Dolutegravir
Artikelnummer: Cay22191-5
Dolutegravir is a potent inhibitor of HIV integrase with an IC50 value of 2.7 nM for HIV-1 integrase-catalyzed strand transfer in vitro. It inhibits HIV-1 viral replication (EC50 = 0.51 nM) in peripheral blood mononuclear cells (PBMCs). The cytotoxic concentration (CC50) values for dolutegravir in unstimulated and...
| Schlagworte: | GSK1349572, S/GSK1349572,... |
| Anwendung: | Antiviral, HIV integrase inhibitor |
| CAS | 1051375-16-6 |
| MW: | 419.4 D |
ab 161,00 €
Dolutegravir-D3
Artikelnummer: ESS0193.10mg
C 56.87% H 3.82% F 9.00% N 9.95% O 18.94% D 1.43%
| Anwendung: | Labelled analog of Dolutegravir |
| CAS | 1051375-16-6 |
| MW: | 422.41 D |
ab 1.558,00 €
