Zu "1049738-54-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ERK-IN-4
Artikelnummer: TGM-T36675-100mg
Description: ERK-IN-4 is a cell-permeable ERK inhibitor with potential antiproliferative effects for the study of diseases caused by immune dysfunction. Target: ERK. Smiles: Cl.O=C1SC(=CC2=CC=C(OCC)C=C2)C(=O)N1CCN. References: Chad N Hancock, et al. Identification of novel extracellular signal-regulated kinase...
| Schlagworte: | ERK Inhibitor |
| Anwendung: | MAPK1 / MAPK3 inhibitor |
| CAS | 1049738-54-6 |
| MW: | 328.814 D |
ab 42,00 €
ERK Inhibitor
Artikelnummer: Cay15944-5
ERK inhibitor is a cell-permeable inhibitor that binds ERK2 near its docking domain (KD = 5 µM). This prevents its interaction with protein substrates without inhibiting catalytic activity. ERK inhibitor blocks ERK-specific phosphorylation of ribosomal S6 kinase-1 and ternary complex factor Elk-1 but does not affect...
| Schlagworte: | Extracellular Regulated Kinase Inhibitor, 3-(2-aminoethyl)-5-[(4-ethoxyphenyl)methylene]-2,4-thiazolidinedione,... |
| Anwendung: | MAPK1 / MAPK3 inhibitor |
| CAS | 1049738-54-6 |
| MW: | 328.8 D |
ab 44,00 €
