Zu "104653-34-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Difethialone
Artikelnummer: TGM-T71543-1mg
Description: Difethialone is an anticoagulant rodenticide and a vitamin K antagonist. Target: Others. Smiles: OC1=C(C2C=3C(CC(C2)C4=CC=C(C=C4)C5=CC=C(Br)C=C5)=CC=CC3)C(=O)SC=6C1=CC=CC6
| Anwendung: | Anticoagulant, Rodenticide |
| CAS | 104653-34-1 |
| MW: | 539.48 D |
775,00 €
Difethialone
Artikelnummer: Cay36225-1
Difethialone is an anticoagulant rodenticide and a vitamin K antagonist. It binds to vitamin K epoxide reductase (VKOR, Kis = 0.04 and 0.05 µM for the wild-type and VKORY139F enzyme, respectively). Difethialone is toxic to mice (LD50 = 1.29 mg/kg). Formulations containing difethialone have been used in the control...
| Schlagworte: | LM 2219, 3-[3-(4'-bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenyl]-4-hydroxy-2H-1-benzothiopyran-2-one |
| Anwendung: | Anticoagulant rodenticide, vitamin K antagonist |
| CAS | 104653-34-1 |
| MW: | 539.5 D |
424,00 €
