Zu "1035270-39-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD4547
Artikelnummer: TGM-T1948-100mg
Description: AZD4547, a new-type specific FGFR inhibitor, targets for FGFR1/2/3 (IC50: 0.2/2.5/1.8 nM in cell-free assays). Target: VEGFR, FGFR. Smiles: COc1cc(CCc2cc(NC(=O)c3ccc(cc3)N3C[C@H](C)N[C@H](C)C3)n[nH]2)cc(OC)c1. References: Gavine PR, et al. AZD4547: an orally bioavailable, potent, and selective...
| Anwendung: | FGFR inhibitor |
| CAS | 1035270-39-3 |
| MW: | 463.57 D |
ab 35,00 €
AZD 4547
Artikelnummer: Cay13111-5
AZD 4547 is a selective inhibitor of the fibroblast growth factor receptor (FGFR) tyrosine kinase with IC50 values of 0.2, 2.5, and 1.8 nM for FGFR1, 2, and 3, respectively. It displays weaker activity against FGFR4 (IC50 = 165 nM), VEGFR2 (IC50 = 24 nM), and a panel of other tyrosine and serine/theronine kinases...
| Schlagworte: | rel-N-[5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl]-4-[(3R,5S)-3,5-dimethyl-1-piperazinyl]-benzamide |
| Anwendung: | FGFR inhibitor |
| CAS | 1035270-39-3 |
| MW: | 463.6 D |
ab 150,00 €
AZD-4547
Artikelnummer: LKT-A9814.10
FGFR inhibitor.
| Schlagworte: | AZD-4547 |
| Anwendung: | FGFR inhibitor |
| CAS | 1035270-39-3 |
| MW: | 463.57 D |
ab 159,00 €
