Zu "103404-75-7" wurden 6 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-Luciferin, sodium salt *UltraPure Grade*
Artikelnummer: ABD-12511
Luciferin is the most popular and versatile bioluminescent substrate.
| Anwendung: | Bioluminescence assays |
| CAS | 103404-75-7 |
ab 108,00 €
D-Luciferin Sodium
Artikelnummer: TGM-T19743-100mg
Description: D-Luciferin Sodium is a heterocyclic light-emitting compound and natural ligand for luciferase used to detect cell activity. The salt form of luciferin dissolves in water or other typical buffers. Target: Others. Smiles: [Na+].Oc1ccc2nc(sc2c1)C1=N[C@H](CS1)C([O-])=O. References: Patrick PS, Lyons SK,...
| Anwendung: | Bioluminescence assays |
| CAS | 103404-75-7 |
| MW: | 302.29 D |
ab 39,00 €
D-Luciferin (sodium salt)
Artikelnummer: Cay14682-1
D-Luciferin is a chemiluminescent substrate of firefly luciferase. It produces light upon oxidative decarboxylation by luciferase in the presence of ATP. D-luciferin can be employed to assay the expression of the luciferase gene linked to a promoter of interest. Alternatively, D-luciferin and luciferase can be used...
| Schlagworte: | 4,5-dihydro-2-(6-hydroxy-2-benzothiazolyl)-4S-thiazolecarboxylic acid, monosodium salt |
| Anwendung: | Chemiluminescent firefly luciferase substrate |
| CAS | 103404-75-7 |
| MW: | 302.3 D |
ab 50,00 €
D-Luciferin sodium salt
Artikelnummer: LKT-L8011.25
D-Luciferin sodium is the water soluble sodium salt of D-luciferin. Protect from light.
| Schlagworte: | 4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid sodium salt |
| Anwendung: | Chemiluminescent firefly luciferase substrate |
| CAS | 103404-75-7 |
| MW: | 302.3 D |
ab 117,00 €
Luciferin, Firefly, Sodium Salt...
Artikelnummer: L6006.1
Luciferin is the substrate for luciferase and is used in highly sensitive bioluminescence assays for the detection of ATP, the generation of light is directly proportional to the concentration of ATP. Also used in detection of the luciferase marker gene. Reconstitution: Reconstitute with nitrogen purged water....
| CAS | 103404-75-7 |
| MW: | 302.30 D |
ab 439,00 €
(4S)-4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazol...
Artikelnummer: 161702.250
| CAS | 103404-75-7 |
454,00 €