Zu "1031367-64-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MC-70
Artikelnummer: TGM-T27985-2mg
Description: MC-70 is a potent P-glycoprotein (P-gp) inhibitor (EC50 = 0.69 µM). Target: Others. Smiles: O(C)C=1C=C2C(CN(CC3=CC=C(C=C3)C4=CC=C(O)C=C4)CC2)=CC1OC. References: Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A. SAR Studies on Tetrahydroisoquinoline...
| Schlagworte: | MC 70, MC70 |
| Anwendung: | P-gp inhibitor |
| CAS | 1031367-64-2 |
| MW: | 375.46 D |
44,00 €
MC70
Artikelnummer: Cay21330-1
MC70 is a P-glycoprotein (P-gp) inhibitor. It inhibits the efflux of [3H]vinblastine by ATP binding cassette subfamily B member 1 (ABCB1) in Caco-2 colon cancer cells (EC50 = 0.05 µM). MC70 also inhibits the efflux of rhodamine-123 (Cay-16672) and calcein-AM (Cay-14948) by breast cancer resistant protein (BCRP) and...
| Schlagworte: | 4'-[(3,4-dihydro-6,7-dimethoxy-2(1H)-isoquinolinyl)methyl]-[1,1'-biphenyl]-4-ol |
| Anwendung: | P-gp inhibitor |
| CAS | 1031367-64-2 |
| MW: | 375.5 D |
ab 77,00 €
