Zu "1025097-10-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cadazolid
Artikelnummer: TGM-T4020-100mg
Description: Cadazolid (ACT-179811) is an oxazolidinone-type antibiotic, with activity against gram-positive bacteria, including Clostridium difficile. Target: Antibiotic, Antibacterial. Smiles: OC[C@H]1CN(C(=O)O1)c1ccc(OCC2(O)CCN(CC2)c2cc3n(cc(C(O)=O)c(=O)c3cc2F)C2CC2)c(F)c1. References: Baldoni D, et al....
| Schlagworte: | ACT-179811 |
| Anwendung: | Antibacterial, Protein biosynthesis inhibitor |
| CAS | 1025097-10-2 |
| MW: | 585.55 D |
ab 32,00 €
Cadazolid
Artikelnummer: Cay23030-5
Cadazolid is an oxazolidinone-type antibiotic that has activity against a panel of C. difficile strains, including those resistant to fluoroquinolones and linezolid (Cay-15012, MICs = 0.125-0.5 µg/ml). It inhibits toxin A and B formation in stationary-phase cultures and spore formation in late exponential cultures...
| Schlagworte: | ACT-179811,... |
| Anwendung: | Antibiotic, Protein synthesis inhibitor |
| CAS | 1025097-10-2 |
| MW: | 585.6 D |
ab 43,00 €
