Zu "102121-60-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AM580
Artikelnummer: TGM-T5854-100mg
Description: AM580 (CD336) is a retinoic acid receptor agonist that is selective for RARalpha( IC50 : 8 nM ). Target: Retinoid Receptor, Autophagy. Smiles: CC1(C)CCC(C)(C)c2cc(ccc12)C(=O)Nc1ccc(cc1)C(O)=O. References: Cheng Y H , Utsunomiya H , Pavone M E , et al. Retinoic acid inhibits endometrial cancer cell...
| Schlagworte: | CD336, NSC608001, Ro 40-6055 |
| Anwendung: | RAR alpha (retinoic acid receptor alpha) agonist |
| CAS | 102121-60-8 |
| MW: | 351.44 D |
ab 33,00 €
AM580
Artikelnummer: Cay15261-1
AM580 is a retinoic acid receptor agonist that is selective for RARalpha (Kd = 8 nM, AC50 = 0.36 nM) compared to RARbeta (Kd = 131 nM, AC50 = 24.6 nM) and RARgamma (Kd = 450 nM, AC50 = 27.9 nM). It demonstrates greater specific binding to RARalpha compared to retinoic acid (Cay-11017), which exhibits little...
| Schlagworte: | CD336, NSC 608001, Ro 40-6055, 4-[[(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)carbonyl]amino]-benzoic acid |
| Anwendung: | RAR alpha (retinoic acid receptor alpha) agonist |
| CAS | 102121-60-8 |
| MW: | 351.4 D |
ab 43,00 €
