Zu "1016535-83-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Oct3/4-inducer-1
Artikelnummer: TGM-T3221-100mg
Description: Oct3/4-inducer-1 (2-(4-(4-methoxybenzyloxy)phenyl)acetonitrile) is an OCT3/4 inducer that promotes the expression and stabilization of OCT3/4 and enhances its transcriptional activity in a variety of human cells. Target: Others, OCT. Smiles: Fc1ccc(COc2ccc(CC#N)cc2)cc1. References: Popp, T., Tallant,...
| Schlagworte: | 2-(4-(4-methoxybenzyloxy)phenyl)acetonitrile |
| Anwendung: | Oct3/4 expression inducer |
| CAS | 1016535-83-3 |
| MW: | 241.26 D |
ab 43,00 €
MDK35833
Artikelnummer: Cay34332-1
MDK35833 is an inducer of octamer-binding transcription factor 3/4 (Oct3/4) expression. It induces Oct3/4 expression in reporter assays using HEK or NCCIT cells when used at a concentration of 10 µM. MDK35833 (20 µM) induces expression of the genes encoding the pluripotency-associated proteins NANOG, REX1, and KLF4...
| Schlagworte: | 4-[(4-fluorophenyl)methoxy]-benzeneacetonitrile |
| Anwendung: | Oct3/4 expression inducer |
| CAS | 1016535-83-3 |
| MW: | 241.3 D |
ab 67,00 €
