Zu "1009816-48-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Thiamet G
Artikelnummer: TGM-T6056-100mg
Description: Thiamet G is a potent, selective O-GlcNAcase inhibitor with Kiof 21 nM, while exhibiting 37, 000-fold selectivity over human lysosomal -hexosaminidase. Target: Autophagy, Others. Smiles: [H][C@]12O[C@H](CO)[C@@H](O)[C@H](O)[C@@]1([H])N=C(NCC)S2. References: Yuzwa SA, et al. Nat Chem Biol. 2008, 4(8),...
| Schlagworte: | TMG |
| Anwendung: | O-GlcNAcase inhibitor |
| CAS | 1009816-48-1 |
| MW: | 248.3 D |
ab 38,00 €
Thiamet G
Artikelnummer: Cay13237-1
Hyperphosphorylation of the tau protein leads to its aggregation and formation of neurofibrillary tangles, a hallmark of Alzheimer's disease and other tauopathic, neurodegenerative disorders. Tau is also dynamically modified by the addition and cleavage of O-linked beta-N-acetylglucosamine (O-GlcNAc) moieties, which...
| Schlagworte: | 2-(ethylamino)-3aR,6S,7R,7aR-tetrahydro-5R-(hydroxymethyl)-5H-pyrano[3,2-d]thiazole-6,7-diol |
| Anwendung: | O-GlcNAcase inhibitor |
| CAS | 1009816-48-1 |
| MW: | 248.3 D |
ab 55,00 €
