Zu "1007459-98-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Carbofuran-d3
Artikelnummer: TGM-TMIH-0138-10mg
Description: Carbofuran-d3 is a deuterated compound of Carbofuran. Smiles: [2H]C([2H])([2H])NC(=O)OC1=C2OC(C)(C)CC2=CC=C1
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, carbamate insecticide, AChE inhibitor |
| CAS | 1007459-98-4 |
| MW: | 224.27 D |
ab 170,00 €
Carbofuran-d3
Artikelnummer: Cay39558-1
Carbofuran-d3 is intended for use as an internal standard for the quantification of carbofuran (Cay-25635) by GC- or LC-MS. Carbofuran is a carbamate insecticide that inhibits acetylcholinesterase (AChE) in insects and mammals (Kas = 9.4, 30, and 210 µM for M. domestica brain, A. mellifera brain, and bovine...
| Schlagworte: | BAY 70143-d3, N-(methyl-d3)-carbamic acid, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, carbamate insecticide, AChE inhibitor |
| CAS | 1007459-98-4 |
| MW: | 224.3 D |
ab 55,00 €
