Zu "1006717-55-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Prazosin-d8
Artikelnummer: TGM-TMIH-0449-1mg
Description: Prazosin-d8 is a deuterated compound of Prazosin. Smiles: [2H]C1([2H])N(C(=O)C2=CC=CO2)C([2H])([2H])C([2H])([2H])N(C2=NC3=C(C=C(OC)C(OC)=C3)C(N)=N2)C1([2H])[2H]
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, antihypertensive agent |
| CAS | 1006717-55-0 |
| MW: | 391.45 D |
ab 228,00 €
Prazosin-d8
Artikelnummer: Cay29094-1
Prazosin-d8 is intended for use as an internal standard for the quantification of prazosin (Cay-15023) by GC- or LC-MS. Prazosin is an antagonist of alpha1-adrenergic receptors (alpha1-ARs). It selectively binds to alpha1-ARs with Ki values of 0.2, 0.25, and 0.32 nM for the human recombinant alpha1A-, alpha1B-, and...
| Schlagworte: | [4-(4-amino-6,7-dimethoxy-2-quinazolinyl)-1-piperazinyl-2,2,3,3,5,5,6,6-d8]-2-furanyl-methanone |
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, antihypertensive agent |
| CAS | 1006717-55-0 |
| MW: | 391.5 D |
448,00 €
