Zu "1001404-83-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Enmetazobactam
Artikelnummer: TGM-T14081-100mg
Description: Enmetazobactam (AAI101) is an extended-spectrum beta-lactamase inhibitor used to treat multi-drug resistant gram-negative bacterial infections. Target: Antibacterial. Smiles: [H][C@@]12CC(=O)N1[C@@H](C([O-])=O)[C@](C)(Cn1cc[n+](C)n1)S2(=O)=O. References: Crandon JL, et al. In Vitro Activity of...
| Schlagworte: | AAI101 |
| Anwendung: | Targets beta-lactamase class C [EC:3.5.2.6] (ampC) |
| CAS | 1001404-83-6 |
| MW: | 314.32 D |
ab 48,00 €
Enmetazobactam
Artikelnummer: Cay30715-10
Enmetazobactam is a beta-lactamase inhibitor. It has greater activity against class A beta-lactamases (IC50s = 0.006-0.52 µM) than class B or class D beta-lactamases (IC50s = 8.7->100 µM). Enmetazobactam in combination with the cephalosporin antibiotic cefepime (Cay-23633) is active against 223 Enterobacteriaceae...
| Schlagworte: | AAI-101,... |
| Anwendung: | Beta-lactamase inhibitor |
| CAS | 1001404-83-6 |
| MW: | 314.3 D |
ab 117,00 €
