Calpain Inhibitor II

Calpain inhibitor II is a cell permeable, peptide aldehyde inhibitor of calpain I (Ki = 120 nM), calpain II (Ki = 230 nM), cathepsin B (Ki = 100 nM), and cathepsin L (Ki = 0.6 nM). It has been used to demonstrate the involvement of ubiquitin-proteasome protein degradation in various biological systems.Formal Name: N-acetyl-L-leucyl-N-[(1S)-1-formyl-3-(methylthio)propyl]-L-leucinamide. CAS Number: 110115-07-6. Synonyms: Ac-Leu-Leu-Met-H, ALLM. Molecular Formula: C19H35N3O4S. Formula Weight: 401.6. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 20 mg/ml, DMSO: 20 mg/ml, Ethanol: 20 mg/ml, Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml. SMILES: O=C[C@@H](NC([C@@H](NC([C@@H](NC(C)=O)CC(C)C)=O)CC(C)C)=O)CCSC. InChi Code: InChI=1S/C19H35N3O4S/c1-12(2)9-16(20-14(5)24)19(26)22-17(10-13(3)4)18(25)21-15(11-23)7-8-27-6/h11-13,15-17H,7-10H2,1-6H3,(H,20,24)(H,21,25)(H,22,26)/t15-,16-,17-/m0/s1. InChi Key: RJWLAIMXRBDUMH-ULQDDVLXSA-N.