CDDO

CDDO is a synthetic oleanane triterpenoid that blocks the cellular synthesis of inducible nitric oxide synthase and inducible COX-2 in INF-gamma-activated mouse macrophages with an IC50 value of 0.4 nM. By suppressing reactive oxygen and nitrogen species (ROS/RNS) formation, it promotes the cellular control of ROS/RNS levels that would lead to DNA damage associated with tumorigenesis. In various cancer cell lines, CDDO has been shown to specifically inhibit proliferation and induce apoptosis. Mechanism studies revealed that CDDO is a ligand for peroxisome proliferator-activated receptor gamma, and also that it induces genes regulated by Nrf2, including heme oxygenase-1 and eotaxin-1, which play a role in antioxidant response element signaling activity.Formal Name: 2-cyano-3,12-dioxo-oleana-1,9(11)-dien-28-oic acid. CAS Number: 218600-44-3. Synonyms: Bardoxolone, RTA 401. Molecular Formula: C31H41NO4. Formula Weight: 491.7. Purity: >95%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 5 mg/ml, DMSO: 5 mg/ml, Ethanol: 5 mg/ml, Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml. lambdamax: 240 nm. SMILES: N#CC1=C[C@@]2(C)[C@](CC[C@]([C@@]3(C)[C@@]4([H])C5[C@@](CCC(C)(C)C5)(C(O)=O)CC3)(C)C2=CC4=O)([H])C(C)(C)C1=O. InChi Code: InChI=1S/C31H41NO4/c1-26(2)10-12-31(25(35)36)13-11-30(7)23(19(31)16-26)20(33)14-22-28(5)15-18(17-32)24(34)27(3,4)21(28)8-9-29(22,30)6/h14-15,19,21,23H,8-13,16H2,1-7H3,(H,35,36)/t19?,21-,23-,28-,29+,30+,31?/m0/s1. InChi Key: TXGZJQLMVSIZEI-RPCUOREFSA-N.