(±)-SKF 81297 (hydrobromide)

(±)-SKF 81297 is a selective agonist of the dopamine D1-like receptor (Ki = 1.9 nM). It demonstrates comparatively lower binding affinity for the dopamine D2, dopamine D3, serotonin 5-HT2A, and adrenergic alpha2 receptors (Kis = 1,272, >10,000, 955, and 509 nM, respectively). Activation of dopamine D1-like receptors by selective agonists such as (±)-SKF 81297 have been implicated in initiating a cascade of signaling events leading to reward-related incentive learning.Formal Name: 6-chloro-2,3,4,5-tetrahydro-1-phenyl-1H-3-benzazepine-7,8-diol, monohydrobromide. CAS Number: 67287-39-2. Synonyms: (±)-6-chloro-PB. Molecular Formula: C16H16ClNO2 . HBr. Formula Weight: 370.7. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 20 mg/ml, DMSO: 20 mg/ml, DMSO:PBS (pH 7.2) (1:20): 0.04 mg/ml, Ethanol: 2 mg/ml. SMILES: OC1=CC2=C(C(Cl)=C1O)CCNCC2C3=CC=CC=C3.Br. InChi Code: InChI=1S/C16H16ClNO2.BrH/c17-15-11-6-7-18-9-13(10-4-2-1-3-5-10)12(11)8-14(19)16(15)20,/h1-5,8,13,18-20H,6-7,9H2,1H. InChi Key: RMIJGBMRNYUZRG-UHFFFAOYSA-N.