Saclofen

Saclofen is a sulfonic analog of the inhibitory neurotransmitter gamma-aminobutyric acid (GABA) that acts as a competitive antagonist of the GABAB receptor (IC50 = 7.8 µM). This compound can be used to determine the functional roles for the GABAB receptor as a mediator of slow inhibitory postsynaptic potentials in the brain.Formal Name: beta-(aminomethyl)-4-chloro-benzeneethanesulfonic acid. CAS Number: 125464-42-8. Molecular Formula: C9H12ClNO3S. Formula Weight: 249.7. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: 0.1 M NaOH: 10 mg/ml, DMSO: 0.3 mg/ml. lambdamax: 220 nm. SMILES: ClC1=CC=C(C(CN)CS(O)(=O)=O)C=C1. InChi Code: InChI=1S/C9H12ClNO3S/c10-9-3-1-7(2-4-9)8(5-11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H,12,13,14). InChi Key: JYLNVJYYQQXNEK-UHFFFAOYSA-N.