Rotenone

Description: Rotenone (Rotocide) is a natural product and a botanical insecticide. Rotenone is a mitochondrial electron transport complex I inhibitor that promotes the production of reactive oxygen species in mitochondria and induces apoptosis. Target: p53, Autophagy, Mitochondrial Metabolism, Apoptosis, Dehydrogenase. Smiles: O=C1C=2C(=C3C(O[C@@H](C(C)=C)C3)=CC2)O[C@]4([C@@]1(C=5C(OC4)=CC(OC)=C(OC)C5)[H])[H]. References: Li N, et al. Mitochondrial complex I inhibitor rotenone induces apoptosis through enhancing mitochondrial reactive oxygen species production. J Biol Chem. 2003 Mar 7,278(10):8516-25.