Roridin E

Description: Roridin E inhibits the receptor tyrosine kinases FGFR3, IGF-1R, PDGFRbeta, and TrkB (IC50s = 0.4, 0.4, 1.4, and 1 µM, respectively) and induces cytotoxicity in multiple breast cancer cell lines (IC50s = 0.02-0.05 nM). It also inhibits proliferation in a panel of additional cancer cell lines (IC50s = <0.01 µM). Target: Others. Smiles: CC(O)C1OCC\C(C)=C\C(=O)OCC23CCC(C)=CC2OC2CC(OC(=O)\C=C/C=C/1)C3(C)C21CO1