Resorufin benzyl ether

Resorufin benzyl ether is a fluorometric probe that acts as a substrate for cytochrome P450 (CYP)3A4. It is typically used near its apparent Km value of 30 µM to screen the inhibition/activation potential of test compounds, to predict potential drug-drug interactions, or to monitor other CYP450 activities. Upon enzyme cleavage, resorufin is released and displays excitation/emission maxima of 570/580 nm, respectively.Formal Name: 7-(phenylmethoxy)-3H-phenoxazin-3-one. CAS Number: 87687-02-3. Synonyms: Benzyloxyresorufin. Molecular Formula: C19H13NO3. Formula Weight: 303.3. Purity: >95%. Emission: 580 nm. Excitation: 570 nm. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 0.3 mg/ml. lambdamax: 210, 250, 460 nm. SMILES: O=C1C=CC2=NC(C=CC(OCC3=CC=CC=C3)=C4)=C4OC2=C1. InChi Code: InChI=1S/C19H13NO3/c21-14-6-8-16-18(10-14)23-19-11-15(7-9-17(19)20-16)22-12-13-4-2-1-3-5-13/h1-11H,12H2. InChi Key: XNZRYTITWLGTJS-UHFFFAOYSA-N.