Osbond acid

Description: Docosapentaenoic acid (DPA), a 22-carbon fatty acid primarily found in fish oil, constitutes a minor fraction of the total unsaturated fatty acids in human serum, with concentrations ranging from 0.1% to 1%, which can increase through dietary supplementation. The all-cis-4,7,10,13,16-DPA variant, also known as Austrian acid, represents a specific isomer of DPA and falls into the omega-6 category, synthesized through the elongation and desaturation of arachidonic acid. In conditions such as fatty acid desaturase syndrome, its levels may decrease, potentially influencing development. Furthermore, conditions like nonalcoholic steatohepatitis, a precursor to hepatocellular carcinoma, are marked by enhanced expression of the hepatic elongase very long fatty acid protein 6 and increased concentrations of very long-chain fatty acids, including all-cis-4,7,10,13,16-DPA. Target: Others. Smiles: C(\C/C=C\C/C=C\C/C=C\CCCCC)=C\C/C=C\CCC(O)=O