Myxochelin A

Description: Myxochelin A is a microbial metabolite found in *A. disciformis* with diverse biological activities. It exhibits activity against Gram-positive bacteria, including *B. cereus*, *S. aureus*, and *M. luteus*, but not against Gram-negative bacteria or fungi at a concentration of 80 µg/disc in an agar diffusion assay. Myxochelin A inhibits 5-lipoxygenase (5-LO) activity, with an IC50 value of 1.9 µM for the recombinant human enzyme. Additionally, it is cytotoxic to 26-L5 colon cancer cells at a concentration of 3 µg/ml. Target: Others. Smiles: OC[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O. References: Kunze, B., Bedorf, N., Kohl, W., et al.Myxochelin A, a new iron-chelating compound from Angiococcus disciformis (Myxobacterales). Production, isolation, physico-chemical and biological propertiesJ. Antibiot. (Tokyo)42(1)14-17(1989)