Isotretinoin

Description: Isotretinoin (13-cis-Retinoic acid) binds to and activates nuclear retinoic acid receptors (RARs), which act as transcription factors that promote cell differentiation and apoptosis. This naturally occurring retinoic acid has potential antineoplastic activity, exhibits immunomodulatory and anti-inflammatory responses, and inhibits ornithine decarboxylase, thereby decreasing polyamine synthesis and keratinization. Target: Autophagy, Retinoid Receptor, Endogenous Metabolite. Smiles: C(=C/C(=C/C=C/C(=C\C(O)=O)/C)/C)\C=1C(C)(C)CCCC1C. References: Webster WS, et al. J Craniofac Genet Dev Biol, 1986, 6(3), 211-222.