FK-866

FK-866 is a highly specific non-competitive inhibitor of Nampt (Ki = 0.4 nM), causing gradual NAD+ depletion. In HepG2 human liver carcinoma cells, NAD+ depletion by FK-866 directs delayed cell death by apoptosis (IC50 = ~1 nM). In normal human smooth muscle cells, FK-866 causes premature senescence, an effect that may be linked to decreased activity of the NAD+-dependent enzyme SIRT1. Also, FK-866 induces autophagy in SH-SY5Y neuroblastoma cells, as indicated by the formation of LC3-positive vesicles.Formal Name: N-[4-(1-benzoyl-4-piperidinyl)butyl]-3-(3-pyridinyl)-2E-propenamide. CAS Number: 658084-64-1. Synonyms: APO-866, Daporinad, K 22.175. Molecular Formula: C24H29N3O2. Formula Weight: 391.5. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 40 mg/ml, DMSO: 25 mg/ml, Ethanol: 50 mg/ml, Ethanol:PBS (pH 7.2) (1:1): 0.5 mg/ml. lambdamax: 257 nm. SMILES: O=C(N1CCC(CCCCNC(/C=C/C2=CN=CC=C2)=O)CC1)C3=CC=CC=C3. InChi Code: InChI=1S/C24H29N3O2/c28-23(12-11-21-8-6-15-25-19-21)26-16-5-4-7-20-13-17-27(18-14-20)24(29)22-9-2-1-3-10-22/h1-3,6,8-12,15,19-20H,4-5,7,13-14,16-18H2,(H,26,28)/b12-11+. InChi Key: KPBNHDGDUADAGP-VAWYXSNFSA-N.