Dexamethasone acetate

Description: Dexamethasone acetate (NSC 39471) is the acetate salt form of Dexamethasone, a synthetic adrenal corticosteroid with potent anti-inflammatory properties. In addition to binding to specific nuclear steroid receptors, dexamethasone also interferes with NF-kB activation and apoptotic pathways. This agent lacks the salt-retaining properties of other related adrenal hormones. Target: Mitophagy, Autophagy, Glucocorticoid Receptor, Antibacterial, Annexin A, NOS, IL Receptor, ADC Cytotoxin. Smiles: [H][C@@]12C[C@@H](C)[C@](O)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C. References: Rickard DJ, et al. Dev Biol, 1994, 161(1), 218-228.