Cridanimod sodium

Description: Cridanimod can increase progesterone receptor (PR) expression, with potential antineoplastic adjuvant activity. Cridanimod is able to induce the expression of PR in endometrial cancer. In combination with a progestin, cancer cells could be eradicated through increased PR-mediated signaling, leading to an inhibition of luteinizing hormone release from the pituitary gland, via a negative feedback mechanism, and, eventually, an inhibition of estrogen released from the ovaries. Target: Others. Smiles: [Na+].[O-]C(=O)CN1C2=C(C=CC=C2)C(=O)C2=C1C=CC=C2