Cholesteryl sulfate sodium

Description: Cholesteryl sulfate sodium (Sodium Cholesteryl Sulfate) is a sterol sulfate in human plasma. Cholesteryl sulfate sodium is a component of cell membrane and has a regulatory function. Cholesteryl sulfate sodium also activates multiple protein kinase C (PKC) iso-enzymes, especially the epsilon, eta and zeta isoforms. Target: Endogenous Metabolite, PKC. Smiles: [Na+].CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OS([O-])(=O)=O. References: Strott CA, et al. Cholesterol sulfate in human physiology: what's it all about? J Lipid Res. 2003 Jul,44(7):1268-78.