CAY10486

Description: Acyl-Coenzyme A: cholesterol acyltransferase-1 and -2 (ACAT-1 and ACAT-2) catalyze the formation of cholesterol esters from cholesterol and long chain fatty acyl-coenzyme A, and may play a role in the development of atherosclerosis. CAY10486 inhibits human ACAT-1 and ACAT-2 equally with an IC50 value of approximately 60 µM. It also inhibits copper-mediated oxidation of low density lipoproteins by about 28% at a concentration of 3 µM. Target: Others. Smiles: [C@@H](CC1=CC=CC=C1)(NC(C=CC2=CC=C(O)C=C2)=O)C(OC)=O