CAY10485

Description: Acyl-coenzyme A: cholesterol acyltransferase-1 and -2 (ACAT-1 and ACAT-2) catalyze the formation of cholesterol esters from cholesterol and long chain fatty acyl-coenzyme A, and may play a role in the development of atherosclerosis. CAY10485 inhibits human ACAT-1 and ACAT-2 with an IC50 values of 95 and 81 µM, respectively. It also inhibits copper-mediated oxidation of low density lipoproteins by 91% at a concentration of 2 µM. Target: Others. Smiles: [C@H](C(OCC1=CC=CC=C1)=O)(NC(CCC2=CC(O)=C(O)C=C2)=O)CC(OCC3=CC=CC=C3)=O