c-Myc inhibitor 7

Description: C-Myc Inhibitor 7, serving as both a c-Myc inhibitor and a multi-target protein degrader, effectively degrades proteins c-MYC, CK1alpha, GSPT1, and IKZF1/2/3 across various tumor cell types. It holds potential for research into diseases associated with high c-Myc expression, including cancer, cardiovascular and cerebrovascular conditions, and viral infections. Target: Others. Smiles: O=C(NCC1=CC=C(C=C1)CNC(=O)CN2C=3N=CC=CC3C4=CC=CC=C42)C5=CC=C6C(=O)N(CC6=C5)C7C(=O)NC(=O)CC7