Benzovindiflupyr

Description: Benzovindiflupyr is a fungicide.1It inhibits mitochondrial complex II, also known as succinate dehydrogenase (SDH, IC50= 5.2 nM), and mycelial growth ofS. sclerotiorum(EC50= 0.011 µg/ml). Benzovindiflupyr (60 µg/ml) completely protects eggplant leaves fromS. sclerotioruminfection. Formulations containing benzovindiflupyr have been used to control various fungal diseases in agriculture. Target: Others. Smiles: N(C(=O)C=1C(C(F)F)=NN(C)C1)C2=C3C4C(=C(Cl)Cl)C(C3=CC=C2)CC4. References: Gao, Y., He, L., Zhu, J., et al.The relationship between features enabling SDHI fungicide binding to the Sc-Sdh complex and its inhibitory activity against Sclerotinia sclerotiorumPest Manag. Sci.76(8)2799-2808(2020)