B 581

Description: B 581 is an inhibitor that specifically blocks farnesylated. Target: Others. Smiles: [C@H](CC1=CC=CC=C1)(C(N[C@@H](CCSC)C(O)=O)=O)NC[C@@H](NC[C@H](CS)N)[C@@H](C)C. References: Cox AD, Garcia AM, Westwick JK, Kowalczyk JJ, Lewis MD, Brenner DA, Der CJ. The CAAX peptidomimetic compound B581 specifically blocks farnesylated, but not geranylgeranylated or myristylated, oncogenic ras signaling and transformation. J Biol Chem. 1994 Jul 29,269(30):19203-6. PubMed PMID: 8034681.