AS-2077715

AS-2077715 is a fungal metabolite and an inhibitor of fungal mitochondrial complex III (cytochrome bc1, IC50 = 80 ng/ml for T. mentagrophytes complex III). It is selective for fungal over mammalian complex III (IC50s = 480 and 860 ng/ml for murine EL-4 cell and human Jurkat cell complex III, respectively). AS-2077715 inhibits ATP production in (IC50 = 0.33 µg/ml) and is fungicidal against T. mentagrophytes when used at concentrations of 1 and 10 µg/ml. In vivo, AS-2077715 (10 and 20 mg/kg) reduces the number of foot pad skin colony forming units (CFUs) in a guinea pig model of T. mentagrophytes infection.Formal Name: 3-[6-(3,5-dimethylheptyl)tetrahydro-2H-pyran-2-yl]-4-hydroxy-1-methyl-5-(2,3,4,5-tetrahydroxycyclopentyl)-2(1H)-pyridinone. CAS Number: 1637356-98-9. Molecular Formula: C25H41NO7. Formula Weight: 467.6. Purity: >70%. Formulation: (Request formulation change), A solid. Solubility: Dichloromethane: soluble, DMSO: soluble, Ethanol: soluble, Methanol: soluble. SMILES: CCC(C)CC(C)CCC1OC(C2=C(O)C(C3C(O)C(O)C(O)C3O)=CN(C)C2=O)CCC1. InChi Code: InChI=1S/C25H41NO7/c1-5-13(2)11-14(3)9-10-15-7-6-8-17(33-15)19-20(27)16(12-26(4)25(19)32)18-21(28)23(30)24(31)22(18)29/h12-15,17-18,21-24,27-31H,5-11H2,1-4H3. InChi Key: PCXGABLZLXTHMH-UHFFFAOYSA-N. Origin: Fungus/Polychaeton sp..